CAS 114290-51-6 appears in our catalog under these names: BAY U6751, >95% (HPLC), BAY U6751 HYDRATE. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 25mg, 5mg.
Disodium;4-(2-chlorophenyl)-1-ethyl-6-methyl-5-propan-2-yloxycarbonyl-4H-pyridine-2,3-dicarboxylate (CAS 114290-51-6) is a chemical compound with the molecular formula C20H20ClNNa2O6 and a molecular weight of 451.8 g/mol. IUPAC name: disodium;4-(2-chlorophenyl)-1-ethyl-6-methyl-5-propan-2-yloxycarbonyl-4H-pyridine-2,3-dicarboxylate. InChIKey: HMSJRRPUSVSTGT-UHFFFAOYSA-L.
| Molecular formula | C20H20ClNNa2O6 |
|---|---|
| Molecular weight | 451.8 g/mol |
| IUPAC name | disodium;4-(2-chlorophenyl)-1-ethyl-6-methyl-5-propan-2-yloxycarbonyl-4H-pyridine-2,3-dicarboxylate |
| InChIKey | HMSJRRPUSVSTGT-UHFFFAOYSA-L |
| SMILES | CCN1C(=C(C(C(=C1C(=O)[O-])C(=O)[O-])C2=CC=CC=C2Cl)C(=O)OC(C)C)C.[Na+].[Na+] |
Computed by PubChem (NCBI)