CAS 1145664-35-2 appears in our catalog under these names: Irbesartan Impurity 15 Sodium Salt, Des-((S)-3-Methyl-2-pentanamidobutanoic Acid) Valsartan 4’-Azidomethyl Sodium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
Sodium 5-[2-[4-(azidomethyl)phenyl]phenyl]-1,2,3-triaza-4-azanidacyclopenta-2,5-diene (CAS 1145664-35-2) is a chemical compound with the molecular formula C14H10N7Na and a molecular weight of 299.27 g/mol. IUPAC name: sodium 5-[2-[4-(azidomethyl)phenyl]phenyl]-1,2,3-triaza-4-azanidacyclopenta-2,5-diene. InChIKey: QIKQKHTWBJFZRK-UHFFFAOYSA-N.
| Molecular formula | C14H10N7Na |
|---|---|
| Molecular weight | 299.27 g/mol |
| IUPAC name | sodium 5-[2-[4-(azidomethyl)phenyl]phenyl]-1,2,3-triaza-4-azanidacyclopenta-2,5-diene |
| InChIKey | QIKQKHTWBJFZRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CN=[N+]=[N-])C3=NN=N[N-]3.[Na+] |
Computed by PubChem (NCBI)