Products 114948-16-2
CAS 114948-16-2 is the registry number for 2,4,6-Tribromobenzen-3,5-d2-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4,6-tribromo-3,5-dideuterioaniline (CAS 114948-16-2) is a chemical compound with the molecular formula C6H4Br3N and a molecular weight of 331.83 g/mol. IUPAC name: 2,4,6-tribromo-3,5-dideuterioaniline. InChIKey: GVPODVKBTHCGFU-QDNHWIQGSA-N.
| Molecular formula | C6H4Br3N |
|---|---|
| Molecular weight | 331.83 g/mol |
| IUPAC name | 2,4,6-tribromo-3,5-dideuterioaniline |
| InChIKey | GVPODVKBTHCGFU-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Br)N)Br)[2H])Br |
Computed by PubChem (NCBI)