CAS 115403-93-5 is the registry number for 2,2'-Biquinoline, ruthenium complex, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
CAS 115403-93-5 identifies a chemical compound with the molecular formula C36H24Cl2N4Ru+2 and a molecular weight of 684.6 g/mol. InChIKey: XDOAXIWHETWNOM-UHFFFAOYSA-N.
| Molecular formula | C36H24Cl2N4Ru+2 |
|---|---|
| Molecular weight | 684.6 g/mol |
| InChIKey | XDOAXIWHETWNOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=NC4=CC=CC=C4C=C3.C1=CC=C2C(=C1)C=CC(=N2)C3=NC4=CC=CC=C4C=C3.[Cl+][Ru][Cl+] |
Computed by PubChem (NCBI)