Products 1156467-77-4
CAS 1156467-77-4 is the registry number for 6-Bromo-3-oxo-2,3-dihydro-1H-indene-5-carbonitrile, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg.
6-bromo-3-oxo-1,2-dihydroindene-5-carbonitrile (CAS 1156467-77-4) is a chemical compound with the molecular formula C10H6BrNO and a molecular weight of 236.06 g/mol. IUPAC name: 6-bromo-3-oxo-1,2-dihydroindene-5-carbonitrile. InChIKey: YRWAJAFDWCBLOV-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO |
|---|---|
| Molecular weight | 236.06 g/mol |
| IUPAC name | 6-bromo-3-oxo-1,2-dihydroindene-5-carbonitrile |
| InChIKey | YRWAJAFDWCBLOV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)Br)C#N |
Computed by PubChem (NCBI)