Products 115875-00-8

CAS 115875-00-8 appears in our catalog under these names: 1,9-Diazaspiro[5.5]undecane-1-carboxylic acid tert-butyl ester, 95%, 1,9-DIazaspiro(5.5)undecane-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate (CAS 115875-00-8) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate. InChIKey: HIKNQHIQQLZTQF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26N2O2
Molecular weight254.37 g/mol
IUPAC nametert-butyl 1,9-diazaspiro[5.5]undecane-1-carboxylate
InChIKeyHIKNQHIQQLZTQF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC12CCNCC2

Computed by PubChem (NCBI)