CAS 116288-58-5 is the registry number for 3,4,6-Triacetate 2-Propen-1-yl 2-(Acetylamino)-2-deoxy-beta-D-galactopyranoside. Offered by: TRC. Available pack sizes: 1g.
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-prop-2-enoxyoxan-2-yl]methyl acetate (CAS 116288-58-5) is a chemical compound with the molecular formula C17H25NO9 and a molecular weight of 387.4 g/mol. IUPAC name: [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-prop-2-enoxyoxan-2-yl]methyl acetate. InChIKey: PRSVMSRDBOXABR-NQNKBUKLSA-N.
| Molecular formula | C17H25NO9 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-prop-2-enoxyoxan-2-yl]methyl acetate |
| InChIKey | PRSVMSRDBOXABR-NQNKBUKLSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OCC=C)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)