CAS 1185300-27-9 is the registry number for 3-(1H-Benzoimidazol-2-yl)-1,2,2-trimethyl-cyclopentanecarboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1H-benzimidazol-2-yl)-1,2,2-trimethylcyclopentane-1-carboxylic acid;hydrochloride (CAS 1185300-27-9) is a chemical compound with the molecular formula C16H21ClN2O2 and a molecular weight of 308.80 g/mol. IUPAC name: 3-(1H-benzimidazol-2-yl)-1,2,2-trimethylcyclopentane-1-carboxylic acid;hydrochloride. InChIKey: VMSLGVJOEGNBMA-UHFFFAOYSA-N.
| Molecular formula | C16H21ClN2O2 |
|---|---|
| Molecular weight | 308.80 g/mol |
| IUPAC name | 3-(1H-benzimidazol-2-yl)-1,2,2-trimethylcyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | VMSLGVJOEGNBMA-UHFFFAOYSA-N |
| SMILES | CC1(C(CCC1(C)C(=O)O)C2=NC3=CC=CC=C3N2)C.Cl |
Computed by PubChem (NCBI)