CAS 1193105-97-3 is the registry number for Imipenem Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2-[4-[2-(aminomethylideneamino)ethylsulfanyl]-5-imino-6-oxooxan-2-yl]-3-hydroxybutanoic acid (CAS 1193105-97-3) is a chemical compound with the molecular formula C12H19N3O5S and a molecular weight of 317.36 g/mol. IUPAC name: (2R,3R)-2-[4-[2-(aminomethylideneamino)ethylsulfanyl]-5-imino-6-oxooxan-2-yl]-3-hydroxybutanoic acid. InChIKey: NQKNHNPPOLNSLI-MDVIFZSFSA-N.
| Molecular formula | C12H19N3O5S |
|---|---|
| Molecular weight | 317.36 g/mol |
| IUPAC name | (2R,3R)-2-[4-[2-(aminomethylideneamino)ethylsulfanyl]-5-imino-6-oxooxan-2-yl]-3-hydroxybutanoic acid |
| InChIKey | NQKNHNPPOLNSLI-MDVIFZSFSA-N |
| SMILES | C[C@H]([C@H](C1CC(C(=N)C(=O)O1)SCCN=CN)C(=O)O)O |
Computed by PubChem (NCBI)