Products 1193687-86-3
CAS 1193687-86-3 appears in our catalog under these names: Raltegravir Impurity 6, Raltegravir Impurity 13. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N'-[2-[4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-1-methyl-6-oxopyrimidin-2-yl]propan-2-yl]oxamide (CAS 1193687-86-3) is a chemical compound with the molecular formula C18H20FN5O5 and a molecular weight of 405.4 g/mol. IUPAC name: N'-[2-[4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-1-methyl-6-oxopyrimidin-2-yl]propan-2-yl]oxamide. InChIKey: YLQCDUADHDPQCG-UHFFFAOYSA-N.
| Molecular formula | C18H20FN5O5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | N'-[2-[4-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-1-methyl-6-oxopyrimidin-2-yl]propan-2-yl]oxamide |
| InChIKey | YLQCDUADHDPQCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC(=C(C(=O)N1C)O)C(=O)NCC2=CC=C(C=C2)F)NC(=O)C(=O)N |
Computed by PubChem (NCBI)