CAS 1193707-19-5 appears in our catalog under these names: NS 30678 hydrochloride, NS 30678 hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 2mg, 25mg, 50mg.
N-[(5-chloro-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-2-yl)methyl]ethanamine;hydrochloride (CAS 1193707-19-5) is a chemical compound with the molecular formula C12H17Cl2NO4S and a molecular weight of 342.2 g/mol. IUPAC name: N-[(5-chloro-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-2-yl)methyl]ethanamine;hydrochloride. InChIKey: ZUZLIKSHWKUMNT-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO4S |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | N-[(5-chloro-7-methylsulfonyl-2,3-dihydro-1,4-benzodioxin-2-yl)methyl]ethanamine;hydrochloride |
| InChIKey | ZUZLIKSHWKUMNT-UHFFFAOYSA-N |
| SMILES | CCNCC1COC2=C(O1)C=C(C=C2Cl)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)