CAS 119725-85-8 is the registry number for Propiconazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]propan-1-ol (CAS 119725-85-8) is a chemical compound with the molecular formula C15H17Cl2N3O3 and a molecular weight of 358.2 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]propan-1-ol. InChIKey: BNNMCHGMWDOQBA-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2N3O3 |
|---|---|
| Molecular weight | 358.2 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]propan-1-ol |
| InChIKey | BNNMCHGMWDOQBA-UHFFFAOYSA-N |
| SMILES | CCC(C1COC(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl)O |
Computed by PubChem (NCBI)