CAS 1202017-92-2 is the registry number for Benidipine Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-[2-(benzylamino)ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 1202017-92-2) is a chemical compound with the molecular formula C25H25N3O6 and a molecular weight of 463.5 g/mol. IUPAC name: 3-O-[2-(benzylamino)ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: KZJIPHOVGJZPIV-UHFFFAOYSA-N.
| Molecular formula | C25H25N3O6 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | 3-O-[2-(benzylamino)ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | KZJIPHOVGJZPIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OCCNCC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)