CAS 1203655-78-0 is the registry number for 4,4,5,5-tetramethyl-2-(4-methyl-3-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4,4,5,5-tetramethyl-2-(4-methyl-3-methylsulfonylphenyl)-1,3,2-dioxaborolane (CAS 1203655-78-0) is a chemical compound with the molecular formula C14H21BO4S and a molecular weight of 296.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methyl-3-methylsulfonylphenyl)-1,3,2-dioxaborolane. InChIKey: WMFPDWIISIZWCA-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methyl-3-methylsulfonylphenyl)-1,3,2-dioxaborolane |
| InChIKey | WMFPDWIISIZWCA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)S(=O)(=O)C |
Computed by PubChem (NCBI)