Products 1207854-61-2
CAS 1207854-61-2 is the registry number for CHM-1-P-Na. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] hydrogen phosphate (CAS 1207854-61-2) is a chemical compound with the molecular formula C16H10FNNaO6P and a molecular weight of 385.21 g/mol. IUPAC name: sodium [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] hydrogen phosphate. InChIKey: ZLFNSIWQUXGDSY-UHFFFAOYSA-M.
| Molecular formula | C16H10FNNaO6P |
|---|---|
| Molecular weight | 385.21 g/mol |
| IUPAC name | sodium [6-(2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] hydrogen phosphate |
| InChIKey | ZLFNSIWQUXGDSY-UHFFFAOYSA-M |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=CC(=N3)C4=CC=CC=C4F)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)