CAS 1213057-20-5 is the registry number for (S)-4-(1-Amino-2,2,2-trifluoroethyl)aniline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-[(1S)-1-amino-2,2,2-trifluoroethyl]aniline (CAS 1213057-20-5) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 4-[(1S)-1-amino-2,2,2-trifluoroethyl]aniline. InChIKey: OBHDPXUAHBSVPI-ZETCQYMHSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]aniline |
| InChIKey | OBHDPXUAHBSVPI-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)N |
Computed by PubChem (NCBI)