Products 1213269-49-8
CAS 1213269-49-8 is the registry number for Levofloxacin Impurity 30. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (2S)-6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate (CAS 1213269-49-8) is a chemical compound with the molecular formula C14H11F2NO4 and a molecular weight of 295.24 g/mol. IUPAC name: methyl (2S)-6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate. InChIKey: CMDHHNXAFMNWPG-LURJTMIESA-N.
| Molecular formula | C14H11F2NO4 |
|---|---|
| Molecular weight | 295.24 g/mol |
| IUPAC name | methyl (2S)-6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate |
| InChIKey | CMDHHNXAFMNWPG-LURJTMIESA-N |
| SMILES | C[C@H]1COC2=C3N1C=C(C(=O)C3=CC(=C2F)F)C(=O)OC |
Computed by PubChem (NCBI)