CAS 1214362-59-0 is the registry number for 3-Iodo-5-phenylpyridine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-iodo-5-phenylpyridine (CAS 1214362-59-0) is a chemical compound with the molecular formula C11H8IN and a molecular weight of 281.09 g/mol. IUPAC name: 3-iodo-5-phenylpyridine. InChIKey: KPYBSPLYNSCWAY-UHFFFAOYSA-N.
| Molecular formula | C11H8IN |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 3-iodo-5-phenylpyridine |
| InChIKey | KPYBSPLYNSCWAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)I |
Computed by PubChem (NCBI)