Products 1217606-96-6
CAS 1217606-96-6 is the registry number for 4-Hydroxy Duloxetine-d6. Offered by: TRC. Available pack sizes: 100mg.
2,3,5,6,7,8-hexadeuterio-4-[3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol (CAS 1217606-96-6) is a chemical compound with the molecular formula C18H19NO2S and a molecular weight of 319.5 g/mol. IUPAC name: 2,3,5,6,7,8-hexadeuterio-4-[3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol. InChIKey: DRRXQCXSBONKPD-CQUKLREESA-N.
| Molecular formula | C18H19NO2S |
|---|---|
| Molecular weight | 319.5 g/mol |
| IUPAC name | 2,3,5,6,7,8-hexadeuterio-4-[3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol |
| InChIKey | DRRXQCXSBONKPD-CQUKLREESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2OC(CCNC)C3=CC=CS3)[2H])[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)