Products 1219192-19-4
CAS 1219192-19-4 is the registry number for 1-Benzyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;hydrochloride (CAS 1219192-19-4) is a chemical compound with the molecular formula C19H19ClN2O2 and a molecular weight of 342.8 g/mol. IUPAC name: 1-benzyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;hydrochloride. InChIKey: GOHZQEOGLTTWFF-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2O2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 1-benzyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;hydrochloride |
| InChIKey | GOHZQEOGLTTWFF-UHFFFAOYSA-N |
| SMILES | C1C(NC(C2=C1C3=CC=CC=C3N2)CC4=CC=CC=C4)C(=O)O.Cl |
Computed by PubChem (NCBI)