CAS 122211-62-5 appears in our catalog under these names: Berkeleylactone E, Berkeleylactone E. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, Get quote.
4-[[(3Z,5R,6S,16R)-5-hydroxy-16-methyl-2-oxo-1-oxacyclohexadec-3-en-6-yl]oxy]-4-oxobutanoic acid (CAS 122211-62-5) is a chemical compound with the molecular formula C20H32O7 and a molecular weight of 384.5 g/mol. IUPAC name: 4-[[(3Z,5R,6S,16R)-5-hydroxy-16-methyl-2-oxo-1-oxacyclohexadec-3-en-6-yl]oxy]-4-oxobutanoic acid. InChIKey: FHTCEVVYDAAWIA-UKHAXTBBSA-N.
| Molecular formula | C20H32O7 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 4-[[(3Z,5R,6S,16R)-5-hydroxy-16-methyl-2-oxo-1-oxacyclohexadec-3-en-6-yl]oxy]-4-oxobutanoic acid |
| InChIKey | FHTCEVVYDAAWIA-UKHAXTBBSA-N |
| SMILES | C[C@@H]1CCCCCCCCC[C@@H]([C@@H](/C=C\C(=O)O1)O)OC(=O)CCC(=O)O |
Computed by PubChem (NCBI)