Products 1238689-36-5
CAS 1238689-36-5 is the registry number for JNJ-42905343. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-oxo-3H-quinazolin-2-yl]pyrazole-4-carboxylic acid (CAS 1238689-36-5) is a chemical compound with the molecular formula C20H15FN4O4 and a molecular weight of 394.4 g/mol. IUPAC name: 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-oxo-3H-quinazolin-2-yl]pyrazole-4-carboxylic acid. InChIKey: GXDKPOPOLNGUNT-UHFFFAOYSA-N.
| Molecular formula | C20H15FN4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-oxo-3H-quinazolin-2-yl]pyrazole-4-carboxylic acid |
| InChIKey | GXDKPOPOLNGUNT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC2=C(C=C3C(=C2)C(=O)NC(=N3)N4C=C(C=N4)C(=O)O)F |
Computed by PubChem (NCBI)