CAS 1240586-96-2 is the registry number for (R)-3-(4-Chlorobenzyl)piperazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-chlorophenyl)methyl]piperazin-2-one (CAS 1240586-96-2) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: 3-[(4-chlorophenyl)methyl]piperazin-2-one. InChIKey: RQKVGBBTWCXFET-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methyl]piperazin-2-one |
| InChIKey | RQKVGBBTWCXFET-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C(N1)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)