CAS 1240613-17-5 appears in our catalog under these names: 2-tert-butyl 3-methyl (3S)-1H,3H,4H,9H-pyrido[3,4-b]indole-2,3-dicarboxylate, 98%, 2-tert-Butyl 3-methyl (3S)-1H,3H,4H,9H-pyrido(3,4-b)indole-2,3-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-O-tert-butyl 3-O-methyl (3S)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxylate (CAS 1240613-17-5) is a chemical compound with the molecular formula C18H22N2O4 and a molecular weight of 330.4 g/mol. IUPAC name: 2-O-tert-butyl 3-O-methyl (3S)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxylate. InChIKey: OBCRBMQFEVKESR-HNNXBMFYSA-N.
| Molecular formula | C18H22N2O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-methyl (3S)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxylate |
| InChIKey | OBCRBMQFEVKESR-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C[C@H]1C(=O)OC)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)