Products 1241390-37-3
CAS 1241390-37-3 is the registry number for (Z)-4-((1,2-Dimethyl-5-oxo-1,5-dihydro-4H-imidazol-4-ylidene)methyl)-2,6-difluorophenyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate (CAS 1241390-37-3) is a chemical compound with the molecular formula C14H12F2N2O3 and a molecular weight of 294.25 g/mol. IUPAC name: [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate. InChIKey: XHUOZYOQFFEPAA-SDQBBNPISA-N.
| Molecular formula | C14H12F2N2O3 |
|---|---|
| Molecular weight | 294.25 g/mol |
| IUPAC name | [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate |
| InChIKey | XHUOZYOQFFEPAA-SDQBBNPISA-N |
| SMILES | CC1=N/C(=C\C2=CC(=C(C(=C2)F)OC(=O)C)F)/C(=O)N1C |
Computed by PubChem (NCBI)