Products 1245706-89-1
CAS 1245706-89-1 is the registry number for 2-Phenethyl-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-(2-phenylethyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (CAS 1245706-89-1) is a chemical compound with the molecular formula C18H17BN2 and a molecular weight of 272.2 g/mol. IUPAC name: 3-(2-phenylethyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene. InChIKey: GDMIBJNSPBSNGY-UHFFFAOYSA-N.
| Molecular formula | C18H17BN2 |
|---|---|
| Molecular weight | 272.2 g/mol |
| IUPAC name | 3-(2-phenylethyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| InChIKey | GDMIBJNSPBSNGY-UHFFFAOYSA-N |
| SMILES | B1(NC2=CC=CC3=C2C(=CC=C3)N1)CCC4=CC=CC=C4 |
Computed by PubChem (NCBI)