Products 1246022-45-6
CAS 1246022-45-6 is the registry number for (Spiro[cyclohexane-1,9′-fluorene]-2′-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Spiro[cyclohexane-1,9'-fluorene]-2'-ylboronic acid (CAS 1246022-45-6) is a chemical compound with the molecular formula C18H19BO2 and a molecular weight of 278.2 g/mol. IUPAC name: spiro[cyclohexane-1,9'-fluorene]-2'-ylboronic acid. InChIKey: FVQJTSOTONOYOG-UHFFFAOYSA-N.
| Molecular formula | C18H19BO2 |
|---|---|
| Molecular weight | 278.2 g/mol |
| IUPAC name | spiro[cyclohexane-1,9'-fluorene]-2'-ylboronic acid |
| InChIKey | FVQJTSOTONOYOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3C24CCCCC4)(O)O |
Computed by PubChem (NCBI)