CAS 1246467-93-5 is the registry number for N,N,N-Trimethyl-5-((2,3,5,6-tetrafluorophenoxy)carbonyl)pyridin-2-aminium chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trimethyl-[5-(2,3,5,6-tetrafluorophenoxy)carbonyl-2-pyridinyl]azanium chloride (CAS 1246467-93-5) is a chemical compound with the molecular formula C15H13ClF4N2O2 and a molecular weight of 364.72 g/mol. IUPAC name: trimethyl-[5-(2,3,5,6-tetrafluorophenoxy)carbonyl-2-pyridinyl]azanium chloride. InChIKey: XPVFCDKZMCAJAV-UHFFFAOYSA-M.
| Molecular formula | C15H13ClF4N2O2 |
|---|---|
| Molecular weight | 364.72 g/mol |
| IUPAC name | trimethyl-[5-(2,3,5,6-tetrafluorophenoxy)carbonyl-2-pyridinyl]azanium chloride |
| InChIKey | XPVFCDKZMCAJAV-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1=NC=C(C=C1)C(=O)OC2=C(C(=CC(=C2F)F)F)F.[Cl-] |
Computed by PubChem (NCBI)