CAS 125085-03-2 is the registry number for Phenyl 2,3-di-O-benzyl-6-deoxy-b-D-thioglucopyranoside. Offered by: Biosynth. Available pack sizes: 1g.
(2R,3R,4S,5R,6S)-2-methyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-ol (CAS 125085-03-2) is a chemical compound with the molecular formula C26H28O4S and a molecular weight of 436.6 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-methyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-ol. InChIKey: JRZKMCCXUTUBSA-FRTMRTDSSA-N.
| Molecular formula | C26H28O4S |
|---|---|
| Molecular weight | 436.6 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-methyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-ol |
| InChIKey | JRZKMCCXUTUBSA-FRTMRTDSSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)SC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)O |
Computed by PubChem (NCBI)