Products 1250997-39-7
CAS 1250997-39-7 is the registry number for 2-Amino-6,7-dihydro-9h-pyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylic acid di-tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ditert-butyl 2-amino-7,9-dihydro-6H-pyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylate (CAS 1250997-39-7) is a chemical compound with the molecular formula C17H27N5O4 and a molecular weight of 365.4 g/mol. IUPAC name: ditert-butyl 2-amino-7,9-dihydro-6H-pyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylate. InChIKey: HYSQSEQOLCFUJX-UHFFFAOYSA-N.
| Molecular formula | C17H27N5O4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | ditert-butyl 2-amino-7,9-dihydro-6H-pyrimido[5,4-e][1,4]diazepine-5,8-dicarboxylate |
| InChIKey | HYSQSEQOLCFUJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2=CN=C(N=C2C1)N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)