CAS 1253792-34-5 appears in our catalog under these names: Dabigatran Impurity 69, DBG-3D Diacid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2,5mg, 25mg.
4-[[5-[2-carboxyethyl(pyridin-2-yl)carbamoyl]-1-methylbenzimidazol-2-yl]methylamino]benzoic acid (CAS 1253792-34-5) is a chemical compound with the molecular formula C25H23N5O5 and a molecular weight of 473.5 g/mol. IUPAC name: 4-[[5-[2-carboxyethyl(pyridin-2-yl)carbamoyl]-1-methylbenzimidazol-2-yl]methylamino]benzoic acid. InChIKey: AMYXAKOLZQXZBB-UHFFFAOYSA-N.
| Molecular formula | C25H23N5O5 |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 4-[[5-[2-carboxyethyl(pyridin-2-yl)carbamoyl]-1-methylbenzimidazol-2-yl]methylamino]benzoic acid |
| InChIKey | AMYXAKOLZQXZBB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)N(CCC(=O)O)C3=CC=CC=N3)N=C1CNC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)