CAS 1254560-90-1 is the registry number for 2,3,4,5,6-Pentafluorophenyl 5-azidopentanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,3,4,5,6-pentafluorophenyl) 5-azidopentanoate (CAS 1254560-90-1) is a chemical compound with the molecular formula C11H8F5N3O2 and a molecular weight of 309.19 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 5-azidopentanoate. InChIKey: NZJMFKWJWLLQFI-UHFFFAOYSA-N.
| Molecular formula | C11H8F5N3O2 |
|---|---|
| Molecular weight | 309.19 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 5-azidopentanoate |
| InChIKey | NZJMFKWJWLLQFI-UHFFFAOYSA-N |
| SMILES | C(CCN=[N+]=[N-])CC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)