Products 1259300-07-6
CAS 1259300-07-6 is the registry number for 1,3,2-Dioxaborolane-2-methanamine, 4,4,5,5-tetramethyl-α-(phenylmethyl)-, hydrochloride (1:1), (αR)-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R)-2-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine;hydrochloride (CAS 1259300-07-6) is a chemical compound with the molecular formula C14H23BClNO2 and a molecular weight of 283.60 g/mol. IUPAC name: (1R)-2-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine;hydrochloride. InChIKey: ZYOYCJQLZFDZIH-YDALLXLXSA-N.
| Molecular formula | C14H23BClNO2 |
|---|---|
| Molecular weight | 283.60 g/mol |
| IUPAC name | (1R)-2-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine;hydrochloride |
| InChIKey | ZYOYCJQLZFDZIH-YDALLXLXSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@H](CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)