Products 1260611-66-2
CAS 1260611-66-2 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(2,4-dimethoxyphenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(2,4-dimethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1260611-66-2) is a chemical compound with the molecular formula C25H23NO6 and a molecular weight of 433.5 g/mol. IUPAC name: (2S)-2-(2,4-dimethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: PWCHHMUOQNPWJD-QHCPKHFHSA-N.
| Molecular formula | C25H23NO6 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | (2S)-2-(2,4-dimethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | PWCHHMUOQNPWJD-QHCPKHFHSA-N |
| SMILES | COC1=CC(=C(C=C1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC |
Computed by PubChem (NCBI)