Products 1260664-23-0
CAS 1260664-23-0 is the registry number for 2-Bromo-7,8-dihydro-1,6-naphthyridin-5(6H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-7,8-dihydro-6H-1,6-naphthyridin-5-one (CAS 1260664-23-0) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 2-bromo-7,8-dihydro-6H-1,6-naphthyridin-5-one. InChIKey: TZAUYGLFOPRZNX-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 2-bromo-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| InChIKey | TZAUYGLFOPRZNX-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1N=C(C=C2)Br |
Computed by PubChem (NCBI)