Products 1260666-73-6
CAS 1260666-73-6 is the registry number for 5-Bromo-1,2,3,4-tetrahydro-2,7-naphthyridin-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-3,4-dihydro-2H-2,7-naphthyridin-1-one (CAS 1260666-73-6) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 5-bromo-3,4-dihydro-2H-2,7-naphthyridin-1-one. InChIKey: KFLWJWILEDINQR-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 5-bromo-3,4-dihydro-2H-2,7-naphthyridin-1-one |
| InChIKey | KFLWJWILEDINQR-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=CN=CC(=C21)Br |
Computed by PubChem (NCBI)