Products 1264043-84-6
CAS 1264043-84-6 is the registry number for 1-(3-Chloro-4-methylphenyl)-3-(ethoxycarbonyl)-5-methyl-4,5-dihydro-1H-pyrazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloro-4-methylphenyl)-5-ethoxycarbonyl-3-methyl-4H-pyrazole-3-carboxylic acid (CAS 1264043-84-6) is a chemical compound with the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. IUPAC name: 2-(3-chloro-4-methylphenyl)-5-ethoxycarbonyl-3-methyl-4H-pyrazole-3-carboxylic acid. InChIKey: YYZCOOQICDDBSJ-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O4 |
|---|---|
| Molecular weight | 324.76 g/mol |
| IUPAC name | 2-(3-chloro-4-methylphenyl)-5-ethoxycarbonyl-3-methyl-4H-pyrazole-3-carboxylic acid |
| InChIKey | YYZCOOQICDDBSJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(C1)(C)C(=O)O)C2=CC(=C(C=C2)C)Cl |
Computed by PubChem (NCBI)