CAS 1264222-51-6 is the registry number for (SP-4-2)-[4,4′-Bis(1,1-dimethylethyl)-2,2′-bipyridine-κN1,κN1′]dichlorocopper, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dichlorocopper (CAS 1264222-51-6) is a chemical compound with the molecular formula C18H24Cl2CuN2 and a molecular weight of 402.8 g/mol. IUPAC name: 4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dichlorocopper. InChIKey: DVTZMYIYECHWCX-UHFFFAOYSA-L.
| Molecular formula | C18H24Cl2CuN2 |
|---|---|
| Molecular weight | 402.8 g/mol |
| IUPAC name | 4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dichlorocopper |
| InChIKey | DVTZMYIYECHWCX-UHFFFAOYSA-L |
| SMILES | CC(C)(C)C1=CC(=NC=C1)C2=NC=CC(=C2)C(C)(C)C.Cl[Cu]Cl |
Computed by PubChem (NCBI)