Products 1268334-91-3

CAS 1268334-91-3 is the registry number for Methyl 4-propyl-4-piperidinecarboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Methyl 4-propylpiperidine-4-carboxylate (CAS 1268334-91-3) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: methyl 4-propylpiperidine-4-carboxylate. InChIKey: AJUVOUMFRPXUHP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO2
Molecular weight185.26 g/mol
IUPAC namemethyl 4-propylpiperidine-4-carboxylate
InChIKeyAJUVOUMFRPXUHP-UHFFFAOYSA-N
SMILESCCCC1(CCNCC1)C(=O)OC

Computed by PubChem (NCBI)