CAS 127448-21-9 is the registry number for Ethyl 7-bromo-4-chloro-1,5-naphthyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 7-bromo-4-chloro-1,5-naphthyridine-3-carboxylate (CAS 127448-21-9) is a chemical compound with the molecular formula C11H8BrClN2O2 and a molecular weight of 315.55 g/mol. IUPAC name: ethyl 7-bromo-4-chloro-1,5-naphthyridine-3-carboxylate. InChIKey: YQUQBOGNQIZCLY-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClN2O2 |
|---|---|
| Molecular weight | 315.55 g/mol |
| IUPAC name | ethyl 7-bromo-4-chloro-1,5-naphthyridine-3-carboxylate |
| InChIKey | YQUQBOGNQIZCLY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C=C(C=NC2=C1Cl)Br |
Computed by PubChem (NCBI)