Products 1279724-72-9
CAS 1279724-72-9 is the registry number for 8-Bromo-2-methylquinazolin-4-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-bromo-2-methylquinazolin-4-amine (CAS 1279724-72-9) is a chemical compound with the molecular formula C9H8BrN3 and a molecular weight of 238.08 g/mol. IUPAC name: 8-bromo-2-methylquinazolin-4-amine. InChIKey: BQGYLPYMEUWYIQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3 |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 8-bromo-2-methylquinazolin-4-amine |
| InChIKey | BQGYLPYMEUWYIQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2Br)C(=N1)N |
Computed by PubChem (NCBI)