Products 1286902-97-3
CAS 1286902-97-3 is the registry number for 1-Methyl-4-[[4-(trifluoromethyl)phenyl]sulfonyl]piperazine, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
1-methyl-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine (CAS 1286902-97-3) is a chemical compound with the molecular formula C12H15F3N2O2S and a molecular weight of 308.32 g/mol. IUPAC name: 1-methyl-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine. InChIKey: GJWGWYJIVXRSRQ-UHFFFAOYSA-N.
| Molecular formula | C12H15F3N2O2S |
|---|---|
| Molecular weight | 308.32 g/mol |
| IUPAC name | 1-methyl-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine |
| InChIKey | GJWGWYJIVXRSRQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)