CAS 129385-61-1 is the registry number for Asenapine Impurity 10. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene-3,5-dione (CAS 129385-61-1) is a chemical compound with the molecular formula C17H10ClNO3 and a molecular weight of 311.7 g/mol. IUPAC name: 9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene-3,5-dione. InChIKey: SXBRBFUCPUGEOA-UHFFFAOYSA-N.
| Molecular formula | C17H10ClNO3 |
|---|---|
| Molecular weight | 311.7 g/mol |
| IUPAC name | 9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7(12),8,10,14,16-heptaene-3,5-dione |
| InChIKey | SXBRBFUCPUGEOA-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C1=O)C3=C(C=CC(=C3)Cl)OC4=CC=CC=C42 |
Computed by PubChem (NCBI)