Products 1304778-22-0
CAS 1304778-22-0 is the registry number for 1,1-Dimethylethyl (3S)-3-(2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)-1-piperidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3S)-3-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (CAS 1304778-22-0) is a chemical compound with the molecular formula C17H23N3O3 and a molecular weight of 317.4 g/mol. IUPAC name: tert-butyl (3S)-3-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate. InChIKey: GQVLYXKGJKVNDU-LBPRGKRZSA-N.
| Molecular formula | C17H23N3O3 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | tert-butyl (3S)-3-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| InChIKey | GQVLYXKGJKVNDU-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)N2C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)