Products 1307911-32-5

CAS 1307911-32-5 is the registry number for Pyrrolidine, 2,3-dimethyl-, hydrochloride (1:1), (2R,3R)-rel-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

(2R,3R)-2,3-dimethylpyrrolidine;hydrochloride (CAS 1307911-32-5) is a chemical compound with the molecular formula C6H14ClN and a molecular weight of 135.63 g/mol. IUPAC name: (2R,3R)-2,3-dimethylpyrrolidine;hydrochloride. InChIKey: CCIXLJCHWWJBLM-KGZKBUQUSA-N.

Identity
Molecular formulaC6H14ClN
Molecular weight135.63 g/mol
IUPAC name(2R,3R)-2,3-dimethylpyrrolidine;hydrochloride
InChIKeyCCIXLJCHWWJBLM-KGZKBUQUSA-N
SMILESC[C@@H]1CCN[C@@H]1C.Cl

Computed by PubChem (NCBI)