CAS 1309610-43-2 appears in our catalog under these names: Sodium (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate, 98%, Resolvin E1 Sodium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 0,25mg, 2,5mg.
Sodium (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate (CAS 1309610-43-2) is a chemical compound with the molecular formula C20H29NaO5 and a molecular weight of 372.4 g/mol. IUPAC name: sodium (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate. InChIKey: WUXDCPCRUFHVSO-AANQWZQHSA-M.
| Molecular formula | C20H29NaO5 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | sodium (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate |
| InChIKey | WUXDCPCRUFHVSO-AANQWZQHSA-M |
| SMILES | CC[C@H](/C=C/C=C\C[C@H](/C=C/C=C/C=C\[C@H](CCCC(=O)[O-])O)O)O.[Na+] |
Computed by PubChem (NCBI)