CAS 1310221-18-1 is the registry number for 6,7-Dichloronaphthalen-1-ol 95%. Offered by: Ambeed. Available pack sizes: 50mg.
6,7-dichloronaphthalen-1-ol (CAS 1310221-18-1) is a chemical compound with the molecular formula C10H6Cl2O and a molecular weight of 213.06 g/mol. IUPAC name: 6,7-dichloronaphthalen-1-ol. InChIKey: HNCOLTQKFTVPCU-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 6,7-dichloronaphthalen-1-ol |
| InChIKey | HNCOLTQKFTVPCU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C(=C1)O)Cl)Cl |
Computed by PubChem (NCBI)