Products 131436-24-3
CAS 131436-24-3 is the registry number for 4-[(2-Methyl-3-quinolinyl)carbonyl]benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
4-(2-methylquinoline-3-carbonyl)benzoic acid (CAS 131436-24-3) is a chemical compound with the molecular formula C18H13NO3 and a molecular weight of 291.3 g/mol. IUPAC name: 4-(2-methylquinoline-3-carbonyl)benzoic acid. InChIKey: NFTQPJJPUIXHKG-UHFFFAOYSA-N.
| Molecular formula | C18H13NO3 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 4-(2-methylquinoline-3-carbonyl)benzoic acid |
| InChIKey | NFTQPJJPUIXHKG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C=C1C(=O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)