Products 13171-96-5
CAS 13171-96-5 is the registry number for Z-Leu-Phe-NH2. Offered by: Biosynth. Available pack sizes: 10g, 25g, 50g.
Benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (CAS 13171-96-5) is a chemical compound with the molecular formula C23H29N3O4 and a molecular weight of 411.5 g/mol. IUPAC name: benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate. InChIKey: IYWAYHYSFZQCSH-PMACEKPBSA-N.
| Molecular formula | C23H29N3O4 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | IYWAYHYSFZQCSH-PMACEKPBSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)