CAS 132855-06-2 is the registry number for 1,1'-(Pyrazine-2,6-diyl)diethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-acetylpyrazin-2-yl)ethanone (CAS 132855-06-2) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: 1-(6-acetylpyrazin-2-yl)ethanone. InChIKey: HQKWPJGYSWKVST-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 1-(6-acetylpyrazin-2-yl)ethanone |
| InChIKey | HQKWPJGYSWKVST-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=CC(=N1)C(=O)C |
Computed by PubChem (NCBI)